Zu "544678-85-5" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
DB04760
Artikelnummer: TGM-T15055-100mg
Description: DB04760 is a highly selective, non-zinc-chelating inhibitor of MMP-13 (IC50: 8 nM). DB04760 obviously decreases paclitaxel neurotoxicity and has anticancer activity. Target: MMP. Smiles: Cc1cc(CNC(=O)c2cc(ncn2)C(=O)NCc2ccc(F)c(C)c2)ccc1F. References: Engel CK, et al. Structural basis for the highly...
| Schlagworte: | MMP-13 Inhibitor |
| Anwendung: | MMP13 inhibitor |
| CAS | 544678-85-5 |
| MW: | 410.42 D |
ab 81,00 €
MMP-13 Inhibitor
Artikelnummer: Cay19540-1
MMP-13 Inhibitor is a pyrimidine dicarboxamide that inhibits matrix metalloproteinase-13 (MMP-13, also known as collagenase-3) with an IC50 value of 8 nM. MMP-13 Inhibitor binds to pockets that are unique to MMP-13, rather than the catalytic zinc, and thus is specific for MMP-13 over other MMPs. MMP-13 Inhibitor...
| Schlagworte: | 4,6-Pyrimidinedicarboxamide, Collagenase-3 Inhibitor, Matrix Metalloproteinase-13 Inhibitor,... |
| Anwendung: | MMP13 inhibitor |
| CAS | 544678-85-5 |
| MW: | 410.4 D |
ab 166,00 €
