Zu "544-72-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Punicic acid
Artikelnummer: TGM-T78472-10mg
Description: Punicic acid, a conjugated isomer of alpha-linolenic acid and a omega-5 polyunsaturated fatty acid found in pomegranate seed oil, holds potential for research into various chronic diseases [1]. Target: Others. Smiles: C(C/C=C\C=C\C=C/CCCC)CCCCCC(O)=O
| Schlagworte: | Trichosanic acid |
| Anwendung: | omega-5 long-chain PUFA, PPARgamma ligand |
| CAS | 544-72-9 |
| MW: | 278.43 D |
ab 198,00 €
9(Z),11(E),13(Z)-Octadecatrienoic Acid
Artikelnummer: Cay26057-1
9(Z),11(E),13(Z)-Octadecatrienoic acid is an omega-5 long-chain polyunsaturated fatty acid and an isomer of 9(E),11(E),13(E)-octadecatrienoic acid (Cay-22976) and of conjugated linoleic acids. It has been found as a major component in pomegranate seed oil, making up approximately 65% of the fatty acid content....
| Schlagworte: | Punicic Acid, Trichosanic Acid, 9Z,11E,13Z-octadecatrienoic acid |
| Anwendung: | omega-5 long-chain PUFA, PPARgamma ligand |
| CAS | 544-72-9 |
| MW: | 278.4 D |
ab 78,00 €
