Zu "541-14-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
D-Carnitine
Artikelnummer: Cay16749-50
D-Carnitine is an isomer of the conditionally essential nutrient L-carnitine (Cay-21489), which facilitates long-chain fatty acid transport into the mitochondrial matrix for beta-oxidation. It inhibits the uptake of L-carnitine by rat kidney brush border membrane vesicles when used at a concentration of 50 µM and by...
| Schlagworte: | (+)-Carnitine, 3-carboxy-2S-hydroxy-N,N,N-trimethyl-1-propanaminium, inner salt |
| Anwendung: | L-carnitine cellular uptake inhibitor |
| CAS | 541-14-0 |
| MW: | 161.2 D |
ab 55,00 €
D-Carnitine
Artikelnummer: TGM-T84847-10mg
Description: D-Carnitine, an orally available isomer of the essential nutrient L-carnitine, facilitates the transport of long-chain fatty acids into the mitochondrial matrix for beta-oxidation. Additionally, D-Carnitine exhibits antiparasitic activity [1] [2] [3]. Target: Others. Smiles: C[N+](C)(C)C[C@@H](O)CC([O-])=O
| CAS | 541-14-0 |
| MW: | 161.201 D |
Bitte fragen Sie den aktuellen Preis für diesen Artikel an.
