Zu "53949-53-4" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
1-Hydroxy-ibuprofen
Artikelnummer: TGM-T38215-10mg
Description: 1-Hydroxy Ibuprofen, a metabolite of Ibuprofen in P. australis[1], functions as an anti-inflammatory inhibitor specifically targeting COX-1 and COX-2, with inhibitory concentration 50 (IC50) values of 13 µM and 370 µM, respectively[1]. Target: Others. Smiles: CC(C)C(O)c1ccc(cc1)C(C)C(O)=O. References:...
| CAS | 53949-53-4 |
| MW: | 222.2802 D |
ab 142,00 €
1-hydroxy Ibuprofen
Artikelnummer: Cay36295-10
1-hydroxy Ibuprofen is a metabolite of the non-steroidal anti-inflammatory drug (NSAID) and non-selective COX inhibitor ibuprofen (Cay-70280, Cay-16793, Cay-16794).Formal Name: 4-(1-hydroxy-2-methylpropyl)-alpha-methyl-benzeneacetic acid. CAS Number: 53949-53-4. Molecular Formula: C13H18O3. Formula Weight: 222.3....
| Schlagworte: | 4-(1-hydroxy-2-methylpropyl)-alpha-methyl-benzeneacetic acid |
| Anwendung: | Ibuprofen metabolite |
| CAS | 53949-53-4 |
| MW: | 222.3 D |
ab 78,00 €
1-Hydroxyibuprofen
Artikelnummer: CDX-H0943-M010
The metabolite 1-Hydroxyibuprofen (Ibuprofen Impurity L) is a degradation product of Ibuprofen which is a non-steroidal anti-inflammatory drug (NSAID) used to relieve pain from various conditions such as headache, dental pain or menstrual cramps. Ibuprofen is an anti-inflammatory inhibitor targeting COX-1 and COX-2....
| Schlagworte: | Ibuprofen Impurity L, Ibuprofen EP Impurity L, 2-[4-(1-Hydroxy-2-methylpropyl)phenyl]propanoic acid, 1-OH IBU |
| Anwendung: | Degradation product |
| CAS | 53949-53-4 |
| MW: | 222.28 D |
117,00 €
