Zu "53846-50-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
8-Prenylnaringenin
Artikelnummer: TGM-TN1146-100mg
Description: 8-Prenylnaringenin is a phytoestrogen with high estrogenic activity,. Target: Apoptosis, ROS. Smiles: CC(C)=CCc1c(O)cc(O)c2C(=O)C[C@H](Oc12)c1ccc(O)cc1. References: 8-prenylnaringenin and tamoxifen inhibit the shedding of irradiated epithelial cells and increase the latency period of radiation-induced...
| Schlagworte: | 8-Prenylnaringenin |
| CAS | 53846-50-7 |
| MW: | 340.37 D |
ab 145,00 €
8-Prenylnaringenin
Artikelnummer: AG-CN2-0525-M001
Pale yellow powder. Soluble in DMF (10mg/ml), DMSO (5mg/ml) or EtOH (2mg/ml). Chemical. CAS: 53846-50-7. Formula: C20H20O5. MW: 340.4. Prenylflavonoid non-steroidal phytoestrogen that mimicks and/or modulates endogenous estrogens via estrogen receptor binding. Inhibits both isoforms of the human estrogen receptor...
| Schlagworte: | (-)-8-Prenylnaringenin, 8-PN, Flavaprenin, Sophoraflavanone B |
| Anwendung: | Estrogen receptor inhibitor |
| CAS | 53846-50-7 |
| MW: | 340,4 D |
ab 61,00 €
