Zu "53716-49-7" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Carprofen
Artikelnummer: TGM-T1325-100mg
Description: Carprofen (Ridamyl) is a propionic acid derivate and nonsteroidal anti-inflammatory drug (NSAID) with anti-inflammatory, analgesic, and antipyretic activities. Target: FAAH, Autophagy, COX. Smiles: ClC=1C=C2C=3C(NC2=CC1)=CC(C(C(O)=O)C)=CC3. References: Ricketts AP, et al. Am J Vet Res, 1998, 59(11),...
| Schlagworte: | Ridamyl, Imadyl, Rimadyl |
| Anwendung: | Targets prostaglandin-endoperoxide synthase 1 [EC:1.14.99.1] (PTGS1, COX1) |
| CAS | 53716-49-7 |
| MW: | 273.71 D |
ab 37,00 €
Carprofen
Artikelnummer: Cay16409-500
Carprofen is a non-steroidal anti-inflammatory drug (NSAID) commonly used in animals to combat pain and inflammation, particularly as associated with osteoarthritis. Like many NSAIDs, carprofen inhibits both cyclooxygenases COX-1 and COX-2 (IC50s = 22.3 and 3.9 µM, respectively). It also inhibits fatty acid amide...
| Schlagworte: | Carprodyl, NSC 297935, 6-chloro-alpha-methyl-9H-carbazole-2-acetic acid |
| Anwendung: | COX-1 / COX-2 inhibitor |
| CAS | 53716-49-7 |
| MW: | 273.7 D |
ab 61,00 €
Carprofen
Artikelnummer: LKT-C0351.1
Carprofen is a non-steroidal anti-inflammatory drug.
| Anwendung: | Anti-inflammatory agent |
| CAS | 53716-49-7 |
| MW: | 273,71 D |
ab 137,00 €
