Zu "537-73-5" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Isoferulic acid
Artikelnummer: TGM-T2889-100mg
Description: Isoferulic acid (Hesperetate) exhibits hypoglycemic properties. Target: Influenza Virus, Adrenergic Receptor. Smiles: COC1=C(O)C=C(\C=C\C(O)=O)C=C1. References: Meeprom A, et al. BMC Complement Altern Med. 2015 Oct 5,15(1):346.
| Schlagworte: | Isoferulate, Hesperetic acid, Hesperetate, 3-Hydroxy-4-methoxycinnamic acid |
| CAS | 537-73-5 |
| MW: | 194.18 D |
ab 42,00 €
Isoferulic Acid
Artikelnummer: Cay22715-1
Isoferulic acid is a cinnamic acid derivative that has antidiabetic activity. It binds to and activates alpha1-adrenergic receptors (IC50 = 1.4 µM) to enhance secretion of beta-endorphin (EC50 = 52.2 nM) and increase glucose use in vitro. Isoferulic acid increases glucose uptake and enhances glycogen synthesis in...
| Schlagworte: | 3-methoxy Caffeic Acid, 3-hydroxy-4-Methoxycinnamic Acid, NSC 51987, 3-(3-hydroxy-4-methoxyphenyl)-2-propenoic acid |
| Anwendung: | Antidiabetic agent |
| CAS | 537-73-5 |
| MW: | 194.2 D |
ab 44,00 €
