Zu "533-67-5" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
2-deoxy-D-Ribose
Artikelnummer: Cay29072-5
2-deoxy-D-Ribose is a reducing sugar formed as a degradation product during metabolism of thymidine (Cay-20519) by thymidine phosphorylase. It increases levels of reactive oxygen species (ROS) in HL-60 human leukemia cells when used at a concentration of 15 mM. 2-deoxy-D-Ribose (10 µM) induces tubulogenesis and...
| Schlagworte: | (3S,4R)-3,4,5-Trihydroxypentanal, 2-Deoxy-D-arabinose, Thyminose, 2-deoxy-D-erythro-pentose |
| Anwendung: | Thymidine degradation product, reducing sugar |
| CAS | 533-67-5 |
| MW: | 134.1 D |
ab 44,00 €
Thyminose
Artikelnummer: TGM-T4818-1g
Description: Thyminose induces apoptosis by inhibiting glutathione synthesis and increasing its efflux. Target: Apoptosis, Endogenous Metabolite, Others. Smiles: OC[C@@H](O)[C@@H](O)CC=O. References: Fico A, et al. 2-deoxy-d-ribose induces apoptosis by inhibiting the synthesis and increasing the efflux of...
| Schlagworte: | 2-Deoxy-D-erythropentose, 2-Deoxy-D-arabinose, 2-Deoxy-D-ribose |
| CAS | 533-67-5 |
| MW: | 134.13 D |
ab 30,00 €
