Zu "53-36-1" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Methylprednisolone Acetate
Artikelnummer: TGM-T21338-100mg
Description: Methylprednisolone Acetate(Depo-Medrate) has the ability to inhibit oxygen free radicals and can be used to treat acute spinal cord injuries. Target: Reactive Oxygen Species. Smiles: CC1CC2C3CCC(O)(C(=O)COC(C)=O)C3(C)CC(O)C2C2(C)C=CC(=O)C=C12. References: Luis M Franco,et al. Immune regulation by...
| Schlagworte: | Depomedrone, Lemod, Depometicort, Depo-Medrin, Depo-Medrate, Depo-medrol |
| CAS | 53-36-1 |
| MW: | 416.51 D |
ab 39,00 €
6alpha-Methylprednisolone-D6-21-Acetate
Artikelnummer: ESS0101.10mg
C 68.22% H 6.20% O 22.72% D 2.86%
| Schlagworte: | (6alpha,11beta)-11,17,21-Trihydroxy-6-methylpregna-1,4-diene-3,20-dione-D6-21-Acetate, Medrone-D6-21-Acetate,... |
| Anwendung: | Labelled analog of 6a-Methyl prednisolone-21-Acetate |
| CAS | 53-36-1 |
| MW: | 422.56 D |
ab 2.308,00 €
6alpha-Methylprednisolone 21-acetate
Artikelnummer: Cay35799-100
6alpha-Methylprednisolone 21-acetate is a synthetic glucocorticoid and an ester form of methylprednisolone (Cay-15013). It reduces IL-1beta-induced production of prostaglandin E2 (PGE2, Cay-14010) and increases in matrix metalloproteinase-13 (MMP-13) levels in equine osteochondral and synovial explant cocultures...
| Schlagworte: | Methylprednisolone Acetate, MPA, NSC 48985, U-8210,... |
| Anwendung: | Methylprednisolone ester, Synthetic glucocorticoid |
| CAS | 53-36-1 |
| MW: | 416.5 D |
ab 76,00 €
