Zu "529-40-8" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Ombuin
Artikelnummer: TGM-TN2010-10mg
Description: Ombuin has anti-inflammatory activity, it inhibits some macrophage functions involved in the inflammatory process. Target: Antibacterial. Smiles: COc1cc(O)c2c(c1)oc(-c1ccc(OC)c(O)c1)c(O)c2=O. References: Antiinflammatory activities of flavonoids and a triterpene caffeate isolated from Bauhinia...
| CAS | 529-40-8 |
| MW: | 330.29 D |
ab 81,00 €
Ombuin
Artikelnummer: Cay40217-1
Ombuin is a flavonoid that has been found in B. balsamifera and has diverse biological activities. It is an antagonist of M1 muscarinic acetylcholine receptors (mAChRs, Ki = 42 µM in CHO-K1 cells expressing the human receptor). Ombuin is cytotoxic to HepG2 hepatocellular carcinoma cells (IC50 = 1.5 µg/ml). In vivo,...
| Schlagworte: | NSC 675952, 3,5-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-7-methoxy-4H-1-benzopyran-4-one |
| Anwendung: | Bioactive flavonoid |
| CAS | 529-40-8 |
| MW: | 330.3 D |
ab 35,00 €
