Zu "527-95-7" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Herbacetin
Artikelnummer: TGM-T5S1331-10mg
Description: 1. Herbacetin induces apoptosis in HepG2 cells, by ROS and PI3K/Akt pathway. 2. Herbacetin suppresses the HGF-induced motility of human breast cancer MDA-MB-231 cells by inhibiting c-Met and Akt phosphorylation. Target: c-Met/HGFR, Akt. Smiles: Oc1ccc(cc1)-c1oc2c(O)c(O)cc(O)c2c(=O)c1O. References: Li L...
| Anwendung: | ODC inhibitor |
| CAS | 527-95-7 |
| MW: | 302.24 D |
ab 40,00 €
Herbacetin
Artikelnummer: Cay19285-1
Herbacetin is a natural product that acts as a selective inhibitor of ornithine decarboxylase (ODC). It inhibits recombinant and HCT116 and HT29 colon cancer cell-derived ODC in a dose-dependent manner while having no effect on 13 tested kinases or S-adenosylmethionine decarboxylase in vitro. Herbacetin suppresses...
| Schlagworte: | 3,5,7,8,4'-Pentahydroxyflavone, 8-hydroxy Kaempferol, Isoarticulatidin,... |
| Anwendung: | ODC inhibitor |
| CAS | 527-95-7 |
| MW: | 302.2 D |
ab 52,00 €
