Zu "522649-59-8" wurden 1 Artikel gefunden!

Für die Filterung wurden keine Ergebnisse gefunden!
Malic enzyme inhibitor ME1
Malic enzyme inhibitor ME1

Artikelnummer: TGM-T11940-100mg

Description: Malic enzyme inhibitor ME1 (ME1) is a specific inhibitor of Malic enzyme (IC50 = 0.15 µM). Malic enzyme inhibitor ME1 reduces cell viability/metabolic activity. Target: Others. Smiles: Oc1ccc(cc1)N1CCN(CC1)C1CC(=O)N(C1=O)c1ccccc1. References: Zhang YJ, et al. In silico design and synthesis of...
Schlagworte: ME1
Anwendung: Malic enzyme inhibitor
CAS 522649-59-8
MW: 351.4 D
ab 67,00 €
Bewerten