Zu "521-31-3" wurden 4 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Luminol
Artikelnummer: TGM-T15792-1g
Description: Luminol (Diogenes reagent)(Diogenes reagent) is a versatile chemical, exhibits chemiluminescence, with a striking blue glow, when mixed with an appropriate oxidizing agent. Target: Others. Smiles: NC1=C2C(=O)NNC(=O)C2=CC=C1. References: Mayer M , Hahn M , Gerstl F , et al. Shedding Light on the...
| Schlagworte: | Diogenes reagent |
| CAS | 521-31-3 |
| MW: | 177.16 D |
ab 31,00 €
Luminol
Artikelnummer: Cay16803-5
Luminol is a cyclic diacyl hydrazide that exhibits chemiluminescence upon oxidation. For example, HRP, combined with hydrogen peroxide as an activator, causes luminescent peroxidation of luminol. This reaction can be enhanced by certain phenol derivatives, such as p-substituted phenols. Luminol can also be oxidized,...
| Schlagworte: | 3-Aminophthalhydrazide, NSC 5064, 5-amino-2,3-dihydro-1,4-phthalazinedione |
| Anwendung: | Chemiluminescence |
| CAS | 521-31-3 |
| MW: | 177.2 D |
ab 60,00 €
Luminol (3-Aminophthalhydrazide) *UltraPure grade*
Artikelnummer: ABD-11050
A luminescent peroxidase substrate.
| Anwendung: | Peroxidase substrate |
| CAS | 521-31-3 |
108,00 €
Luminol
Artikelnummer: CDX-L0012-G025
White to light yellow powder. Soluble in water (50mg/ml). Very efficient and commonly used chemiluminiscent compound in many applications. Cyclic diacyl hydrazide that exhibits chemiluminescence upon oxidation. Oxidizing agents capable of initiating this particular reaction are nitrogen dioxide, PAN, hydrogen...
| Schlagworte: | 3-Aminophthalhydrazide, 5-Amino-2,3-dihydro-1,4-phthalazinedione, NSC5064 |
| Anwendung: | Chemiluminescent compound |
| CAS | 521-31-3 |
| MW: | 177,16 D |
ab 183,00 €
