Zu "52-24-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Thio-TEPA
Artikelnummer: TGM-T1250-100mg
Description: Thio-TEPA (Tiofosyl) is a polyfunctional, organophosphorus alkylating agent with antineoplastic activity. Target: DNA Alkylator/Crosslinker, DNA Alkylation, Antibacterial, Antibiotic. Smiles: P(=S)(N1CC1)(N2CC2)N3CC3. References: Gor PP, et al. Breast Y Res. 2010,12(3):R26.
| Schlagworte: | Tiofosfamid, Tiofosyl, Triethylenethiophosphoramide |
| Anwendung: | Antineoplastic, Alkylating agent |
| CAS | 52-24-4 |
| MW: | 189.22 D |
ab 31,00 €
Thio-TEPA
Artikelnummer: Cay23745-250
Thio-TEPA is an alkylating agent with anticancer activity (IC50 = 1.5 µM against P388 murine leukemia cells). It alkylates DNA and inhibits thymidine incorporation (IC50 = 2 µM) inducing irreversible DNA damage. Thio-TEPA crosslinks guanine nucleotides and induces cell cycle arrest via the formation of interstrand...
| Schlagworte: | NCI C01649, NSC 6396, Triethylenethiophosphoramide, 1,1',1''-phosphinothioylidynetris-aziridine |
| Anwendung: | Alkylating agent |
| CAS | 52-24-4 |
| MW: | 189.2 D |
ab 67,00 €
