Zu "51798-45-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Elastatinal
Artikelnummer: TGM-T20130-10mg
Description: Elastatinal is an elastase inhibitor. It is found in culture filtrates of various species of actinomyces. Target: Others. Smiles: [C@H](C(N[C@H](C(N[C@H](C=O)C)=O)CCC(N)=O)=O)(NC(N[C@@H](CC(C)C)C(O)=O)=O)[C@]1(NC(N)=NCC1)[H]. References: Maxson T, Tietz JI, Hudson GA, Guo XR, Tai HC, Mitchell DA....
| Schlagworte: | BRN-0873543, BRN0873543, BRN 0873543 |
| CAS | 51798-45-9 |
| MW: | 512.56 D |
ab 228,00 €
Elastatinal
Artikelnummer: Cay22288-5
Elastatinal is a potent inhibitor of pancreatic elastase (Ki = 240 nM) that is produced by various species of Actinomycetes. It more strongly inhibits pancreatic elastase versus the leukocyte-derived enzyme. Elastatinal reduces electrophoretic mobilities of 2A proteinases from poliovirus and human rhinovirus 14 in a...
| Schlagworte: | (2S)-2-[(4S)-2-amino-3,4,5,6-tetrahydro-4-pyrimidinyl]-N-[[[(1S)-1-carboxy-3-methylbutyl]amino]carbonyl]glycyl-N1-[(1S)-1-... |
| Anwendung: | Pancreatic elastase inhibitor |
| CAS | 51798-45-9 |
| MW: | 512.6 D |
ab 125,00 €
