Zu "508186-14-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Ac-CoA Synthase Inhibitor1
Artikelnummer: TGM-T4380-100mg
Description: Ac-CoA Synthase Inhibitor1 (ACSS2 inhibitor) is the most potent and specific inhibitor of acetate-dependent acetyl-CoA synthetase 2 (ACSS2). Target: RSV, Fatty Acid Synthase. Smiles: COCCNC(=O)Nc1ccc2nc(-c3cccs3)c(nc2c1)-c1cccs1. References: Comerford SA,etal.Acetate dependence of tumors.Cell. 2014 Dec...
| Schlagworte: | ACSS2 inhibitor |
| Anwendung: | ACSS2 inhibitor |
| CAS | 508186-14-9 |
| MW: | 410.51 D |
ab 42,00 €
Acetyl-CoA Synthase Inhibitor
Artikelnummer: Cay36023-5
Acetyl-CoA synthase inhibitor is an inhibitor of acetyl-CoA synthetase 2 (ACCS2, IC50 = 1.214 µM). It reduces oleic acid-induced increases in the number of histone H2AX-positive cells, a marker of DNA damage, in cultured human immortalized hepatocytes when used at a concentration of 50 µM.Formal Name:...
| Schlagworte: | ACCS2 Inhibitor, MDK6149, VY-3-249, N-(2,3-di-2-thienyl-6-quinoxalinyl)-N'-(2-methoxyethyl)-urea |
| Anwendung: | ACCS2 inhibitor |
| CAS | 508186-14-9 |
| MW: | 410.5 D |
ab 137,00 €
