Zu "5081-48-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Ellipticine hydrochloride
Artikelnummer: TGM-T4614-100mg
Description: Ellipticine hydrochloride (NSC-71795 (hydrochloride)) is a potent antineoplastic agent, inhibits DNA topoisomerase II activities. Target: Topoisomerase. Smiles: Cl.Cc1c2[nH]c3ccccc3c2c(C)c2cnccc12. References: Stiborova M, et al. Molecular mechanisms of antineoplastic action of an anticancer drug...
| Schlagworte: | NSC 71795 (hydrochloride), Ellipticine HCl |
| Anwendung: | Antitumor agent |
| CAS | 5081-48-1 |
| MW: | 282.76 D |
ab 42,00 €
Ellipticine (hydrochloride)
Artikelnummer: Cay18742-10
Ellipticine is an alkaloid isolated from Apocyanaceae plants that exhibits antitumor activities by intercalating into DNA and/or inhibiting DNA topoisomerase II. It forms covalent adducts in DNA after being enzymatically activated with cytochrome P450 isoforms (e.g., CYP3A4, CYP1A1, or CYP1A2) or by peroxidases in...
| Schlagworte: | NSC 71795, 5,11-dimethyl-6H-pyrido[4,3-b]carbazole |
| Anwendung: | Antitumor agent |
| CAS | 5081-48-1 |
| MW: | 282.8 D |
ab 90,00 €
