Zu "507475-17-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
TPCA-1
Artikelnummer: TGM-T3049-100mg
Description: TPCA-1 (TPCA1) is an effective and specific IKK-2 inhibitor (IC50: 17.9 nM), shows >22-fold selectivity over IKK-1 and >550-fold selectivity over others kinases and enzymes. Target: Apoptosis, IkappaB/IKK, STAT. Smiles: NC(=O)Nc1sc(cc1C(N)=O)-c1ccc(F)cc1. References: Podolin PL, et al, J Pharmacol Exp...
| Schlagworte: | IKK2 Inhibitor IV, TPCA1, GW683965 |
| Anwendung: | IkappaB kinase-2 inhibitor |
| CAS | 507475-17-4 |
| MW: | 279.29 D |
ab 38,00 €
TPCA-1
Artikelnummer: Cay15115-10
TPCA-1 is a selective inhibitor of IkappaB kinase-2 (IC50s = 17.9 nM and 0.40 µM for IKK2 and IKK1, respectively). Furthermore, it displays greater than 550-fold selectivity over other kinases and enzymes including, p38, MAPK, COX, and JNK. TPCA-1 inhibits the production of LPS-induced TNF-alpha, IL-6, and IL-8 with...
| Schlagworte: | IKK2 Inhibitor IV, 2-[(aminocarbonyl)amino]-5-(4-fluorophenyl)-3-thiophenecarboxamide |
| Anwendung: | IkappaB kinase-2 inhibitor |
| CAS | 507475-17-4 |
| MW: | 279.3 D |
ab 92,00 €
