Zu "50700-72-6" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Vecuronium bromide
Artikelnummer: TGM-T1594-100mg
Description: Vecuronium bromide (ORG NC 45) is a synthetic, intermediate-acting, mono-quaternary steroid that functions as a non-depolarizing neuromuscular blocking agent with muscle relaxant properties. Target: AChR. Smiles: [Br-].CC(=O)OC1C(CC2C3CCC4CC(OC(C)=O)C(CC4(C)C3CCC12C)N1CCCCC1)[N+]1(C)CCCCC1. References:...
| Schlagworte: | ORG NC 45 |
| Anwendung: | Skeletal muscle relaxant, Neuromuscular blocking agent, Muscarinic acetylcholine receptor antagonist |
| CAS | 50700-72-6 |
| MW: | 637.73 D |
ab 31,00 €
Vecuronium Bromide
Artikelnummer: LKT-V1810.10
A nonpolarizing neuromuscular relaxant.
| Schlagworte: | NC-45, Org-NC-45 |
| Anwendung: | Muscle-type nicotinic cholinergic receptor antagonist |
| CAS | 50700-72-6 |
| MW: | 637,74 D |
ab 128,00 €
Vecuronium (bromide)
Artikelnummer: Cay15603-10
Vecuronium is a non-depolarizing muscle relaxant derived from the aminosteroid pancuronium (Cay-23778) and used adjunctively to general anesthesia. It competitively blocks cholinergic receptors at the motor end plate of the neuromuscular junction, inducing temporary paralysis. In humans, it has been shown to reduce...
| Schlagworte: | NC 45, 1-[(2beta,3alpha,5alpha,16beta,17beta)-3,17-bis(acetyloxy)-2-(1-piperidinyl)androstan-16-yl]-1-methyl-piperidinium,... |
| Anwendung: | Muscle-type nicotinic cholinergic receptor antagonist |
| CAS | 50700-72-6 |
| MW: | 637.7 D |
ab 83,00 €
