Zu "5054-59-1" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Thalidomide-4-OH
Artikelnummer: TGM-T7763-500mg
Description: Thalidomide-4-OH (E3 ligase Ligand 2) (Cereblon ligand 2) is the Thalidomide-based Cereblon ligand used to recruit of CRBN protein. Thalidomide-4-OH (Cereblon ligand 2) is a linker to form PROTACs. Target: Ligand for E3 Ligase. Smiles: OC1=CC=CC2=C1C(=O)N(C1CCC(=O)NC1=O)C2=O. References: Marks MG, et...
| Schlagworte: | Cereblon ligand 2, E3 ligase Ligand 2 |
| Anwendung: | Protac(R) reagent |
| CAS | 5054-59-1 |
| MW: | 274.23 D |
30,00 €
E3 Ligase Ligand 2
Artikelnummer: Cay36664-1
E3 ligase ligand 2 is an active metabolite of thalidomide (Cay-14610) and an intermediate in the synthesis of proteolysis-targeting chimeras (PROTACs) containing thalidomide, a ligand for the E3 ubiquitin ligase cereblon (CRBN), used in targeted protein degradation. E3 ligase ligand 2 is formed from thalidomide via...
| Schlagworte: | 4-hydroxy Thalidomide, 2-(2,6-dioxo-3-piperidinyl)-4-hydroxy-1H-isoindole-1,3(2H)-dione |
| Anwendung: | Thalidomide active metabolite, PROTAC synthetic intermediate |
| CAS | 5054-59-1 |
| MW: | 274.2 D |
ab 40,00 €
4-Hydroxy-thalidomide
Artikelnummer: BPS-82001
4-Hydroxy-thalidomide is the Thalidomide-based Cereblon ligand used in the recruitment of CRBN protein. It can be connected to the ligand for protein by a linker to form PROTACs.
| Anwendung: | Protac(R) reagent |
| CAS | 5054-59-1 |
| MW: | 274,2 D |
810,00 €
