Zu "50-41-9" wurden 4 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Clomiphene citrate
Artikelnummer: TGM-T1193-1g
Description: Clomiphene citrate (NSC 35770) is a selective estrogen receptor modulator. Target: Estrogen Receptor/ERR, Estrogen/progestogen Receptor. Smiles: OC(=O)CC(O)(CC(O)=O)C(O)=O.CCN(CC)CCOc1ccc(cc1)C(=C(\Cl)c1ccccc1)\c1ccccc1. References: Batra S, et al. Cancer Chemother Pharmacol,1990, 26(4), 310-312.
| Schlagworte: | NSC 35770, Clomifene citrate |
| Anwendung: | Ovulation inducing agent, Gonadotropin stimulant, Estrogen receptor agonist/antagonist |
| CAS | 50-41-9 |
| MW: | 598.1 D |
ab 45,00 €
Clomiphene (citrate)
Artikelnummer: Cay16087-1
Clomiphene is a selective estrogen receptor modulator that impairs the activation of estrogen receptors (ERs) by 17beta-estradiol. It potently binds both ERalpha and ERbeta (Ki = 0.9 and 1.2 nM, respectively). Clomiphene enhances the release of gonadotropin-releasing hormone, stimulating the release of...
| Schlagworte: | Clomifene, NSC 35770, Omifin, 2-[4-(2-chloro-1,2-diphenylethenyl)phenoxy]-N,N-diethyl-ethanamine... |
| Anwendung: | Selective estrogen receptor modulator |
| CAS | 50-41-9 |
| MW: | 598.1 D |
ab 44,00 €
Clomiphene Citrate
Artikelnummer: LKT-C4559.1
Used for in vitro fertilization, FIASMA, SERM.
| Schlagworte: | Clomid, Clomphid, Clostilbegyt, Dyneric, Pergotime, Serophene, Clomifene, 2-[4-(2-Chloro-1,2-diphenylethenyl)phenoxy]-N,N-... |
| Anwendung: | Estrogen receptor 1 agonist/antagonist, estrogen receptor 2 agonist/antagonist |
| CAS | 50-41-9 |
| MW: | 598.09 D |
ab 69,00 €
Clomiphene citrate
Artikelnummer: CDX-C0696-G001
Clomiphene is a nonsteroidal triphenylethylene derivative. It acts as a selective estrogen receptor modulator (SERM), that impairs the activation of estrogen receptors (ERs) by 17beta-estradiol, similar to tamoxifen and raloxifene. It potently binds both ERalpha and ERbeta (Ki = 0.9 and 1.2nM, respectively)....
| Schlagworte: | Clomifene, Omifin, NSC 35770, 2-(4-[2-Chloro-1,2-diphenylethenyl]phenoxy)-N,N-diethylethanamine, Clomiphene citrate salt |
| Anwendung: | Estrogen receptor agonist/antagonist |
| CAS | 50-41-9 |
| MW: | 598.08 D |
ab 37,00 €
