Zu "497-30-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Ergothioneine
Artikelnummer: TGM-T8191-10mg
Description: Ergothioneine (L-(+)-Ergothioneine) is synthesized by certain bacteria and fungi. It is generally considered an antioxidant. Target: Antioxidant, Endogenous Metabolite. Smiles: [C@@H](CC=1NC(=S)NC1)([N@@+](C)(C)C)C([O-])=O. References: Oumari M, et al. Regeneration of ergothioneine after reaction with...
| Schlagworte: | L-(+)-Ergothioneine |
| Anwendung: | Antioxidant |
| CAS | 497-30-3 |
| MW: | 229.3 D |
ab 77,00 €
L-(+)-Ergothioneine
Artikelnummer: Cay14905-5
L-(+)-Ergothioneine is a naturally-occurring amino acid derived from histidine via hercynine. Ergothioneine is a stable antioxidant that scavenges and detoxifies free radicals and oxidants, increases intracellular thiol levels, controls nuclear factor-kappaB activation, and inhibits inflammatory gene expression. In...
| Schlagworte: | 2-Mercaotohistidine betaine, NSC 7175, alphaS-carboxy-2,3-dihydro-N,N,N-trimethyl-2-thioxo-inner... |
| Anwendung: | Antioxidant |
| CAS | 497-30-3 |
| MW: | 229.3 D |
ab 84,00 €
