Zu "496864-15-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
RP-106
Artikelnummer: TGM-T24734-1mg
Description: RP-106 is an ATP-competitive inhibitor of CDK5/p25, CDK1/cyclin B, and GSK-3. Target: Others. Smiles: C(CCC)C1=C(NC=2C1=NC=CN2)C3=CC=C(OC)C=C3. References: Dong B, Chen J, Zhang X, Pan Z, Bai F, Li Y. Two novel PRP31 premessenger ribonucleic acid processing factor 31 homolog mutations including a...
| Schlagworte: | RP 106 |
| Anwendung: | CDK1/cyclin B inhibitor |
| CAS | 496864-15-4 |
| MW: | 281.35 D |
ab 81,00 €
Aloisine RP106
Artikelnummer: Cay21873-1
Aloisine is an inhibitor of Cdk1/cyclin B, Cdk5/p25, and GSK3 (IC50s = 0.70, 1.5, and 0.92 µM, respectively). It is a derivative of the aloisines A and B, which competitively inhibit ATP binding to the catalytic subunit of CDKs and GSKs.Formal Name: 7-butyl-6-(4-methoxyphenyl)-5H-pyrrolo[2,3-b]pyrazine. CAS Number:...
| Schlagworte: | 7-butyl-6-(4-methoxyphenyl)-5H-pyrrolo[2,3-b]pyrazine |
| Anwendung: | CDK1/cyclin B inhibitor |
| CAS | 496864-15-4 |
| MW: | 281.4 D |
ab 44,00 €
