Zu "49671-76-3" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
ZLN005
Artikelnummer: TGM-T1802-100mg
Description: ZLN005 is an effective and tissue-specific transcriptional activator of PGC-1alpha. Target: Autophagy. Smiles: CC(C)(C)c1ccc(cc1)-c1nc2ccccc2[nH]1. References: Zhang LN, et al. Diabetes. 2013, 62(4), 1297-1307.
| Anwendung: | PGC-1alpha expression stimulator |
| CAS | 49671-76-3 |
| MW: | 250.34 D |
ab 31,00 €
ZLN005
Artikelnummer: Cay14121-5
Peroxisome proliferator-activated receptor-gamma coactivator-1alpha (PGC-1alpha) is a tissue-specific and inducible transcriptional coactivator for several nuclear receptors and plays a key role in energy metabolism, hepatic gluconeogenesis, and cholesterol homoeostasis. ZLN005 is a small molecule that stimulates...
| Schlagworte: | 2-[4-(1,1-dimethylethyl)phenyl]-1H-benzimidazole |
| Anwendung: | PGC-1alpha expression stimulator |
| CAS | 49671-76-3 |
| MW: | 250.3 D |
ab 52,00 €
ZLN005
Artikelnummer: LKT-Z4552.10
PPARgamma coactivator-1alpha expression stimulator.
| Anwendung: | PPARgamma coactivator-1alpha expression stimulator |
| CAS | 49671-76-3 |
| MW: | 250.35 D |
ab 117,00 €
