Zu "49557-75-7" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Glycyl-L-Histidyl-L-Lysine
Artikelnummer: TGM-T4508-100mg
Description: Glycyl-L-histidyl-L-lysine is a synthetic hepatotrophic agent and liver cell growth factor that stimulates the production of hepatic erythropoietic factor. Target: Others. Smiles: [C@H](CC1=CN=CN1)(C(N[C@@H](CCCCN)C(O)=O)=O)NC(CN)=O. References: Naughton BA,etal.The influence of pancreatic hormones and...
| CAS | 49557-75-7 |
| MW: | 340.38 D |
ab 30,00 €
GHK
Artikelnummer: Cay27168-1
GHK is a peptide released during extracellular matrix (ECM) protein degradation following tissue injury. It binds to copper to form GHK-Cu, a complex with diverse biological activities, including roles in tissue remodeling and wound healing, hair growth, and suppression of inflammation. GHK (1 µM) increases...
| Schlagworte: | Gly-His-Lys, NSC 379527, glycyl-L-histidyl-L-lysine |
| Anwendung: | Tissue injury extracellular matrix (ECM) protein degradation peptide |
| CAS | 49557-75-7 |
| MW: | 340.4 D |
ab 44,00 €
TRIPEPTIDE-1
Artikelnummer: CSB-DT1693.1
Cosmetic peptides are degraded small-molecule collagen proteins, typically composed of amino acid groups or residues ranging from 2 to 10 amino acids, linked in a specific sequence by peptide bonds. Due to their ability to stimulate collagen synthesis, aid wound healing, smooth wrinkles, and possess antioxidant,...
| Schlagworte: | Gly-His-Lys, GHK |
| Anwendung: | Cosmetic peptide |
| CAS | 49557-75-7 |
| MW: | 340.382 D |
191,00 €
