Zu "4825-86-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Ochratoxin B
Artikelnummer: TGM-T124797-1mg
Description: Ochratoxin B is produced by a variety of Aspergillus and Penicillium species and is an analog of the mycotoxin Ochratoxin A, which can contaminate agricultural products. Target: Endogenous Metabolite. Smiles: OC1=C2C(=CC=C1C(N[C@@H](CC3=CC=CC=C3)C(O)=O)=O)C[C@@H](C)OC2=O. References: Mally A, et al....
| CAS | 4825-86-9 |
| MW: | 369.37 D |
152,00 €
Ochratoxin B
Artikelnummer: Cay16167-500
Ochratoxin B (OTB) is a mycotoxin that has been found in Aspergillus and is a non-chlorinated derivative of OTA (Cay-11439). Unlike OTA, OTB is not genotoxic to HepG2 cells but does inhibit cell division when used at concentrations ranging from 1 to 25 µg/ml. It induces mortality (LC50 = 700 nM) and craniofacial...
| Schlagworte: | OTB, N-[[(3R)-3,4-dihydro-8-hydroxy-3-methyl-1-oxo-1H-2-benzopyran-7-yl]carbonyl]-L-phenylalanine |
| Anwendung: | Mycotoxin |
| CAS | 4825-86-9 |
| MW: | 369.4 D |
ab 149,00 €
