Zu "48208-26-0" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
RG108
Artikelnummer: TGM-T2038-100mg
Description: RG108 (N-Phthalyl-L-tryptophan) is a DNA methyltransferase inhibitor with an IC50 of 115 nM. Target: DNA Methyltransferase. Smiles: [C@H](CC=1C=2C(NC1)=CC=CC2)(C(O)=O)N3C(=O)C=4C(C3=O)=CC=CC4. References: Brueckner B, et al, Cancer Res, 2005, 65(14), 6305-6311.
| Schlagworte: | N-Phthalyl-L-tryptophan |
| Anwendung: | DNA methyltransferase inhibitor |
| CAS | 48208-26-0 |
| MW: | 334.33 D |
ab 40,00 €
RG108
Artikelnummer: Cay13302-10
DNA methylation regulates gene expression in normal and malignant cells. RG108 is a non-nucleoside DNA methyltransferase inhibitor (IC50 = 115 nM in vitro). It significantly reduces the methylation of genomic DNA in cells at 10 µM without detectable toxicity, distinguishing it from nucleoside-based inhibitors like...
| Schlagworte: | N-Phthalyl-L-Tryptophan, alpha-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)-(alphaS)-1H-indole-3-propanoic acid |
| Anwendung: | DNA methyltransferase inhibitor |
| CAS | 48208-26-0 |
| MW: | 334.3 D |
ab 85,00 €
RG-108
Artikelnummer: LKT-R2400.10
DNMT inhibitor.
| Anwendung: | DNMT inhibitor |
| CAS | 48208-26-0 |
| MW: | 334.33 D |
ab 125,00 €
