Zu "479-92-5" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Propyphenazone
Artikelnummer: TGM-T5010-10g
Description: Propyphenazone (4-Isopropylantipyrine), a pyrazolone derivative, exhibits anti-inflammatory, analgesic, and antipyretic properties and acts as a precursor for prodrugs and selective cyclooxygenase-2 inhibitors. Target: COX. Smiles: CC(C)C1=C(C)N(C)N(C1=O)C1=CC=CC=C1. References: Radwan MF, et al....
| Schlagworte: | 4-Isopropylantipyrine, Isopropyrine, Isopropylphenazone, Isopropylantipyrine, Propyphenazone (4-Isopropylantipyrine) |
| Anwendung: | Analgesic, Antipyretic |
| CAS | 479-92-5 |
| MW: | 230.31 D |
ab 42,00 €
Propyphenazone
Artikelnummer: CDX-P0090-M100
White to off-white powder. Soluble in chloroform. Analgesic, antipyretic, and anti-inflammatory compound.
| Schlagworte: | Isopropylphenazone, 4-Isopropylantipyrine, 4-Isopropyl-1,5-dimethyl-2-phenyl-1H-pyrazol-3(2H)-one |
| Anwendung: | Analgesic, Antipyretic, Antiinflammatory |
| CAS | 479-92-5 |
| MW: | 230,3 D |
ab 77,00 €
