Zu "474432-66-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
FAUC-365
Artikelnummer: TGM-T21667-100mg
Description: FAUC-365 is a D3 dopamine receptor agonist. Target: Dopamine Receptor. Smiles: Clc1cccc(N2CCN(CCCCNC(=O)c3cc4ccccc4s3)CC2)c1Cl. References: Bettinetti L, Schlotter K, Hübner H, Gmeiner P. Interactive SAR studies:rational discovery of super-potent and highly selective dopamine D3 receptor antagonists and...
| Schlagworte: | FAUC-365 Benzo[b]thiophene-2-carboxylic acid {4-[4-(2,3-dichloro- phenyl)-piperazin-1-yl]-butyl}-amide, FAUC-365... |
| CAS | 474432-66-1 |
| MW: | 462.44 D |
ab 48,00 €
FAUC-365
Artikelnummer: Cay20457-1
FAUC-365 is a dopamine D3 receptor antagonist (Ki = 0.5 nM). It is selective for dopamine D3 receptors over dopamine D1, D2L, D2S, and D4 receptors (Kis = 8.8, 3.6, 2.6, and 0.34 µM, respectively) as well as the serotonin (5-HT) receptor subtypes 5-HT1A and 5-HT2 (Kis = 0.36 and 2 µM, respectively). FAUC-365 (1-10...
| Schlagworte: | N-[4-[4-(2,3-dichlorophenyl)-1-piperazinyl]butyl]-benzo[b]thiophene-2-carboxamide |
| Anwendung: | Dopamine D3 receptor antagonist |
| CAS | 474432-66-1 |
| MW: | 462.4 D |
ab 60,00 €
