Zu "472981-92-3" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
SB-366791
Artikelnummer: TGM-T6977-100mg
Description: SB-366791 is a new and selective cinnamide TRPV1 antagonist. Target: TRP/TRPV Channel. Smiles: COC1=CC=CC(NC(=O)\C=C\C2=CC=C(Cl)C=C2)=C1. References: Gunthorpe MJ,et al. Identification and characterisation of SB-366791, a potent and selective vanilloid receptor (VR1/TRPV1) antagonist. Neuropharmacology....
| Schlagworte: | SB366791 |
| Anwendung: | TRPV1 antagonist |
| CAS | 472981-92-3 |
| MW: | 287.74 D |
ab 33,00 €
SB-366791
Artikelnummer: Cay11019-5
The transient receptor potential vanilloid type 1 (TRPV1) receptor is a nonselective cation channel gated by noxious heat, protons, and capsaicin. TRPV1 is present in primary sensory neurons and in both central and peripheral sensory nerve terminals and plays a role in thermal and mechanical hyperalgesia. SB-366791...
| Schlagworte: | 3-(4-chlorophenyl)-N-(3-methoxyphenyl)-2-propenamide |
| Anwendung: | TRPV1 antagonist |
| CAS | 472981-92-3 |
| MW: | 287.7 D |
ab 81,00 €
SB366791
Artikelnummer: AG-CR1-0034-M025
Potent and selective TRPV1 antagonist, Glutamatergic synaptic transmission inhibitor.
| Schlagworte: | N-(3-Methoxyphenyl)-4-chlorocinnamide |
| Anwendung: | TRPV1 antagonist |
| CAS | 472981-92-3 |
| MW: | 287,8 D |
ab 61,00 €
