Zu "4727-31-5" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Kartogenin
Artikelnummer: TGM-T1748-100mg
Description: Kartogenin (KGN) is an activator of the smad4/smad5 pathway, and promotes the selective differentiation of multipotent mesenchymal stem cells into chondrocytes. Target: TGF-beta/Smad. Smiles: OC(=O)c1ccccc1C(=O)Nc1ccc(cc1)-c1ccccc1. References: Johnson K, et al. Science. 2012, 336(6082), 717-721.
| Schlagworte: | KGN |
| Anwendung: | Chondrogenesis inducer |
| CAS | 4727-31-5 |
| MW: | 317.34 D |
ab 31,00 €
Kartogenin
Artikelnummer: Cay11826-10
Kartogenin potently induces differentiation of human mesenchymal stem cells into chondrocytes with an EC50 value of 100 nM. Kartogenin induces chondrogenesis by binding the actin-binding protein, filamin A, which disrupts its interaction with the transcription factor core-binding factor beta subunit (CBFbeta). When...
| Schlagworte: | 2-[([1,1'-biphenyl]-4-ylamino)carbonyl]-benzoic acid |
| Anwendung: | Chondrogenesis inducer |
| CAS | 4727-31-5 |
| MW: | 317.3 D |
ab 87,00 €
Kartogenin
Artikelnummer: LKT-K0271.25
Collagen synthesis stimulator.
| Anwendung: | Collagen synthesis stimulator |
| CAS | 4727-31-5 |
| MW: | 317.34 D |
ab 128,00 €
