Zu "4725-51-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Annaosanchun
Artikelnummer: TGM-T19659-10mg
Description: Annaosanchun (YC-6) is potentially for the treatment of acute ischemic stroke (AIS). Target: AMPK, Others. Smiles: C[C@@]12[C@@]3([C@]([C@]4([C@](C)(CC3)CCC4)[H])(C[C@@H](O)[C@@]1(O)C[C@@H](O)CC2)[H])[H]
| Schlagworte: | YC6, YC 6, YC-6 |
| CAS | 4725-51-3 |
| MW: | 308.46 D |
ab 40,00 €
Annaosanchun
Artikelnummer: Cay37572-1
Annaosanchun is a synthetic sterol and neuroprotectant agent. It increases the viability of, and the levels of ATP and the mitochondrial membrane potential in, hypoxia-exposed and reoxygenated primary rat cortical neurons when used at concentrations of 0.1, 0.3, and 1 µM. Annaosanchun (10 µM) prevents...
| Schlagworte: | androstane-3beta,5alpha,6beta-triol |
| Anwendung: | Synthetic sterol, neuroprotective agent |
| CAS | 4725-51-3 |
| MW: | 308.5 D |
ab 35,00 €
