Zu "4673-26-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Diphenyleneiodonium chloride
Artikelnummer: TGM-T7191-100mg
Description: Diphenyleneiodonium chloride (DPI)(DPI) is an irreversible inhibitor of iNOS and eNOS (IC50 values of 50 nM and 0.3 µM, respectively),and displays broad-spectrum bactericidal activity. Target: TRP/TRPV Channel, NADPH, Reactive Oxygen Species, NOS. Smiles: [Cl-].[I+]1c2ccccc2-c2ccccc12. References:...
| Schlagworte: | DPI |
| Anwendung: | iNOS inhibitor, eNOS inhibitor |
| CAS | 4673-26-1 |
| MW: | 314.55 D |
ab 38,00 €
Diphenyleneiodonium (chloride)
Artikelnummer: Cay81050-10
Diphenyleneiodonium (DPI) is an inhibitor of NADPH oxidase (NOX, EC50 = 0.1 µM in HeLa cells). It also inhibits nitric oxide synthase (NOS, IC50 = 0.05 µM in isolated mouse peritoneal macrophages). DPI (10, 50, and 100 µM) induces the production of reactive oxygen species (ROS) in, and apoptosis of, human umbilical...
| Schlagworte: | DPI, dibenziodolium chloride |
| Anwendung: | iNOS inhibitor, eNOS inhibitor |
| CAS | 4673-26-1 |
| MW: | 314.5 D |
ab 60,00 €
