Zu "4673-26-1" wurden 2 Artikel gefunden!

Für die Filterung wurden keine Ergebnisse gefunden!
Diphenyleneiodonium (chloride)
Diphenyleneiodonium (chloride)

Artikelnummer: Cay81050-10

Diphenyleneiodonium (DPI) is an inhibitor of NADPH oxidase (NOX, EC50 = 0.1 µM in HeLa cells). It also inhibits nitric oxide synthase (NOS, IC50 = 0.05 µM in isolated mouse peritoneal macrophages). DPI (10, 50, and 100 µM) induces the production of reactive oxygen species (ROS) in, and apoptosis of, human umbilical...
Schlagworte: DPI, dibenziodolium chloride
Anwendung: iNOS inhibitor, eNOS inhibitor
CAS 4673-26-1
MW: 314.5 D
ab 61,00 €
Bewerten
Diphenyleneiodonium chloride
Diphenyleneiodonium chloride

Artikelnummer: TGM-T7191-100mg

Description: Diphenyleneiodonium chloride (DPI)(DPI) is an irreversible inhibitor of iNOS and eNOS (IC50 values of 50 nM and 0.3 µM, respectively),and displays broad-spectrum bactericidal activity. Target: TRP/TRPV Channel, NADPH, Reactive Oxygen Species, NOS. Smiles: [Cl-].[I+]1c2ccccc2-c2ccccc12. References:...
Schlagworte: DPI
Anwendung: iNOS inhibitor, eNOS inhibitor
CAS 4673-26-1
MW: 314.55 D
ab 40,00 €
Bewerten