Zu "447410-57-3" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
SB756050
Artikelnummer: TGM-T4352-100mg
Description: SB756050 is a specific TGR5 agonist. Target: GPCR19. Smiles: COc1ccc(cc1OC)S(=O)(=O)N1CCCN(CC1)S(=O)(=O)c1ccc(OC)c(OC)c1. References: Hodge RJ, et al. Safety, Pharmacokinetics, and Pharmacodynamic Effects of a Selective TGR5 Agonist, SB-756050, in Type 2 Diabetes. Clin Pharmacol Drug Dev. 2013...
| Schlagworte: | SB-756050, SB 756050 |
| Anwendung: | TGR5 agonist |
| CAS | 447410-57-3 |
| MW: | 500.59 D |
ab 35,00 €
SB-756050
Artikelnummer: Cay27998-10
SB-756050 is an agonist of the bile acid G protein-coupled receptor TGR5 (EC50 = 1.3 µM for the human receptor). It is selective for TGR5 over the farnesoid X receptor (FXR) and a panel of other receptors, channels, and transporters. SB-756050 (10-100 mg/kg) decreases fasting glucose levels and increases glucose...
| Schlagworte: | 1,4-bis[(3,4-dimethoxyphenyl)sulfonyl]hexahydro-1H-1,4-diazepine |
| Anwendung: | TGR5 agonist |
| CAS | 447410-57-3 |
| MW: | 500.6 D |
ab 44,00 €
