Zu "446-86-6" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Azathioprine
Artikelnummer: TGM-T1237-1g
Description: Azathioprine (BW 57-322), an immunosuppressive agent, inhibits purine synthesis and GTP-binding protein Rac1 activation. Target: GPR, Apoptosis, Rho. Smiles: CN1C=NC(=C1SC1=NC=NC2=C1NC=N2)[N+]([O-])=O. References: Tiede I, et al. J Clin Invest, 2003, 111(8), 1133-1145.
| Schlagworte: | BW 57-322 |
| Anwendung: | Immunosuppressant, Nucleic acid biosynthesis inhibitor |
| CAS | 446-86-6 |
| MW: | 277.26 D |
ab 45,00 €
Azathioprine
Artikelnummer: Cay13987-500
Azathioprine is a purine analog with immunosuppressive effects. It serves as a prodrug for 6-mercaptopurine, which alters purine processing and DNA synthesis, interfering with the proliferation of lymphocytes and other myeloid cells. Its immunomodulating actions are used to benefit inflammatory bowel disease, as...
| Schlagworte: | Azamune, Azoran, BW 57-322, Imuran, NSC 39084, 6-[(1-methyl-4-nitro-1H-imidazol-5-yl)thio]-9H-purine |
| Anwendung: | Immunosuppressive compound |
| CAS | 446-86-6 |
| MW: | 277.3 D |
ab 57,00 €
Azathioprine
Artikelnummer: LKT-A9803.1
Is an immunosuppressant. It is a purine synthesis inhibitor which inhibits the proliferation of cells.
| Anwendung: | Purine synthesis inhibitor |
| CAS | 446-86-6 |
| MW: | 277,26 D |
ab 156,00 €
