Zu "4429-63-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Tabersonine
Artikelnummer: TGM-T3246-100mg
Description: Tabersonine (Tabersonin)is a terpene indole alkaloid found in the medicinal plant Catharanthus roseus. Target: Others. Smiles: CC[C@]12CC(C(=O)OC)=C3Nc4ccccc4[C@]33CCN(CC=C1)[C@H]23
| Schlagworte: | (-)-Tabersonine, Tabersonin |
| Anwendung: | Bioactive indole alkaloid, Abeta42 fibril formation inhibitor |
| CAS | 4429-63-4 |
| MW: | 336.43 D |
ab 36,00 €
Tabersonine
Artikelnummer: Cay26848-1
Tabersonine is an indole alkaloid that has been found in the beans of Voacanga. It inhibits amyloid-beta (1-42) (Abeta42) fibril formation and disintegrates preformed Abeta42 fibrils in vitro when used at a concentration of 10 µM. Tabersonine is an intermediate in the biosynthesis of vindoline, a precursor in the...
| Schlagworte: | (-)-Tabersonine, (5alpha,12R,19alpha)-2,3,6,7-tetradehydro-aspidospermidine-3-carboxylic acid, methyl ester |
| Anwendung: | Bioactive indole alkaloid, Abeta42 fibril formation inhibitor |
| CAS | 4429-63-4 |
| MW: | 336.4 D |
ab 60,00 €
