Zu "432001-69-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Skp2 Inhibitor C1
Artikelnummer: TGM-T4253-100mg
Description: Skp2 Inhibitor C1 (SKPin C1)(SKPin C1) is a specific small molecule inhibitor of Skp2-mediated p27 degradation. Target: E1/E2/E3 Enzyme, Others. Smiles: OC(=O)COc1ccc(Br)cc1\C=C1/SC(=S)N(Cc2cccnc2)C1=O. References: Wu L, et al. Specific small molecule inhibitors of Skp2-mediated p27 degradation. Chem...
| Schlagworte: | SKPin C1 |
| Anwendung: | Skp2 inhibitor |
| CAS | 432001-69-9 |
| MW: | 465.34 D |
ab 37,00 €
SKPin C1
Artikelnummer: Cay26141-5
SKPin C1 is an inhibitor of Skp1-Cullin1-F-box (SCF) family protein Skp2-mediated p27 degradation. It binds to Skp2 at the Cdc kinase subunit 1 (Cks1) interaction interface and blocks ubiquitylation of p27 in a Cks1-dependent manner in vitro when used at a concentration of 50 µM. SKPin C1 increases nuclear...
| Schlagworte: | 2-[4-bromo-2-[[4-oxo-3-(3-pyridinylmethyl)-2-thioxo-5-thiazolidinylidene]methyl]phenoxy]-acetic acid |
| Anwendung: | Skp2-mediated p27 degradation inhibitor |
| CAS | 432001-69-9 |
| MW: | 465.3 D |
ab 112,00 €
