Zu "426834-38-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
NS 3694
Artikelnummer: Cay19190-10
Cytochrome c, which leaks from the mitochondrial intermembrane space into the cytosol, causes oligomerization of apoptotic protease-activating factor 1 (Apaf-1), forming a caspase activation complex known as the apoptosome. NS 3694 is a cell-permeable diarylurea compound that inhibits apoptosome formation and...
| Schlagworte: | Apoptosis Inhibitor II, 4-chloro-2-[[[[3-(trifluoromethyl)phenyl]amino]carbonyl]amino]-benzoic acid |
| Anwendung: | Apoptosome formation & caspase activation inhibitor |
| CAS | 426834-38-0 |
| MW: | 358.7 D |
ab 88,00 €
NS3694
Artikelnummer: TGM-T22119-100mg
Description: NS3694 is an inhibitor of apoptosis and inhibits apoptosome formation and caspase activation. Target: Apoptosis. Smiles: OC(=O)c1ccc(Cl)cc1NC(=O)Nc1cccc(c1)C(F)(F)F. References: Ulrik Lademann, et al. Diarylurea compounds inhibit caspase activation by preventing the formation of the active...
| Anwendung: | Apoptosome formation & caspase activation inhibitor |
| CAS | 426834-38-0 |
| MW: | 358.7 D |
ab 32,00 €
