Zu "42017-89-0" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Fenofibric acid
Artikelnummer: TGM-T1402-1g
Description: Fenofibric acid (FNF acid) is the active form of fenofibrate, a synthetic phenoxy-isobutyric acid derivate with antihyperlipidemic activity. Target: MMP, COX, PPAR. Smiles: C(=O)(C1=CC=C(OC(C(O)=O)(C)C)C=C1)C2=CC=C(Cl)C=C2. References: Arakawa R, et al. Arterioscler Thromb Vasc Biol. 2005,...
| Schlagworte: | NSC 281318, Trilipix, FNF acid |
| Anwendung: | Targets peroxisome proliferator-activated receptor alpha (NR1C1, PPARA) |
| CAS | 42017-89-0 |
| MW: | 318.75 D |
ab 31,00 €
Fenofibric Acid
Artikelnummer: Cay19262-500
Fenofibric acid is an agonist of peroxisome proliferator-activated receptor alpha (PPARalpha), PPARgamma, and PPARdelta (EC50s = 22.4, 1.47, and 1.06 µM, respectively, in a transactivation assay) and an active metabolite of the PPARalpha agonist fenofibrate (Cay-10005368). It is formed by the hydrolysis of...
| Schlagworte: | FNF Acid, NSC 281318, 2-[4-(4-chlorobenzoyl)phenoxy]-2-methyl-propanoic acid |
| Anwendung: | PPAR alpha agonist, antihyperlipidemic |
| CAS | 42017-89-0 |
| MW: | 318.8 D |
ab 43,00 €
