Zu "41906-86-9" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Nitrocefin
Artikelnummer: TGM-T19709-100mg
Description: Nitrocefin is an antibiotic. It being sensitive to hydrolysis by all lactamases produced by gram-positive and gram-negative bacteria. Target: Others. Smiles: OC(=O)C1=C(CS[C@@H]2[C@H](NC(=O)Cc3cccs3)C(=O)N12)\C=C\c1ccc(cc1[N+]([O-])=O)[N+]([O-])=O. References: Boehle KE, Gilliand J, Wheeldon CR, Holder...
| Anwendung: | Chromogenic beta-lactamase substrate |
| CAS | 41906-86-9 |
| MW: | 516.5 D |
ab 66,00 €
Nitrocefin
Artikelnummer: Cay15424-25
The generation of beta-lactamases by bacteria affords resistance to several classes of beta-lactam antibiotics, including penicillins and cephalosporins. Nitrocefin is a chromogenic cephalosporin substrate commonly used to detect beta-lactamases in bacteria. The presence of beta-lactamase activity is indicated by...
| Schlagworte: | Nitrocephin,... |
| Anwendung: | Chromogenic beta-lactamase substrate |
| CAS | 41906-86-9 |
| MW: | 516.5 D |
ab 116,00 €
