Zu "418805-02-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
PYR-41
Artikelnummer: TGM-T6629-100mg
Description: PYR-41 is the first cell-permeable inhibitor of ubiquitin-activating enzyme E1, with no activity at E2. Target: Apoptosis, E1/E2/E3 Enzyme. Smiles: CCOC(=O)c1ccc(cc1)N1NC(=O)\C(=C\c2ccc(o2)[N+]([O-])=O)C1=O. References: Yang Y, et al. Cancer Res, 2007, 67(19), 9472-9481.
| Schlagworte: | PYR 41, PYR41 |
| Anwendung: | Cell-permeable, irreversible ubiquitin-activating enzyme (E1) inhibitor |
| CAS | 418805-02-4 |
| MW: | 371.3 D |
ab 33,00 €
PYR41
Artikelnummer: Cay15226-1
PYR41 is an irreversible inhibitor of ubiquitin-activating enzyme (E1) with an IC50 value of less than 10 µM. PYR41 specifically inhibits ubiquitin-thioester bond formation (IC50 = 6.4 µM) and not adenylation. It is selective for E1 over ubiquitin-conjugating enzyme (E2) but does inhibit autoubiquitination of the...
| Schlagworte: | 4-[4-[(5-nitro-2-furanyl)methylene]-3,5-dioxo-1-pyrazolidinyl]-benzoic acid, ethyl ester |
| Anwendung: | Cell-permeable, irreversible ubiquitin-activating enzyme (E1) inhibitor |
| CAS | 418805-02-4 |
| MW: | 371.3 D |
ab 35,00 €
