Zu "412950-27-7" wurden 1 Artikel gefunden!

Für die Filterung wurden keine Ergebnisse gefunden!
Goxalapladib
Goxalapladib

Artikelnummer: TGM-T67799-10mg

Description: Goxalapladib(GSK 677116) is a small molecule compound that can be used to treat cardiovascular risks associated with atherosclerosis. Target: Others. Smiles: C(C(N(CC1=CC=C(C=C1)C2=CC=C(C(F)(F)F)C=C2)C3CCN(CCOC)CC3)=O)N4C=5C(C(=O)C=C4CCC6=C(F)C(F)=CC=C6)=CC=CN5. References: Devanabanda B, Kasi A....
Schlagworte: GSK 677116
Anwendung: Targets platelet-activating factor acetylhydrolase [EC:3.1.1.47] (PLA2G7, PAFAH)
CAS 412950-27-7
MW: 718.75 D
ab 194,00 €
Bewerten