Zu "412940-35-3" wurden 1 Artikel gefunden!

Für die Filterung wurden keine Ergebnisse gefunden!
CTP inhibitor
CTP inhibitor

Artikelnummer: TGM-T61297-100mg

Description: CTP inhibitor is a highly effective and specific inhibitor of the plasma membrane citrate transporter (PMCT), effectively targeting and inhibiting the transporter responsible for citrate transport. [1]. Target: Others. Smiles: OC(=O)C1=CC(=C(Cl)C=C1)S(=O)(=O)NC1=CC(=CC=C1)[N+]([O-])=O
Anwendung: Na(+)/citrate cotransporter inhibitor
CAS 412940-35-3
MW: 356.74 D
ab 1.520,00 €
Bewerten