Zu "41083-73-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
6alpha-hydroxy Cholesterol
Artikelnummer: TGM-T35977-25mg
Description: 6alpha-hydroxy Cholesterol is an oxysterol that increases superoxide anion production in SK-N-BE cells when used at concentrations of 50 and 100 µM. Target: Others. Smiles: CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3C[C@H](O)[C@H]4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C
| Schlagworte: | 6alpha-hydroxy Cholesterol, 6alpha-OHC |
| CAS | 41083-73-2 |
| MW: | 404.67 D |
ab 317,00 €
6alpha-hydroxy Cholesterol
Artikelnummer: Cay25715-10
6alpha-hydroxy Cholesterol is an oxysterol that increases superoxide anion production in SK-N-BE cells when used at concentrations of 50 and 100 µM.Formal Name: (5alpha)-cholestane-3beta,6alpha-diol. CAS Number: 41083-73-2. Synonyms: 6alpha-OHC. Molecular Formula: C27H48O2. Formula Weight: 404.7. Purity: >95%....
| Schlagworte: | 6alpha-OHC, (5alpha)-cholestane-3beta,6alpha-diol |
| Anwendung: | Oxysterol |
| CAS | 41083-73-2 |
| MW: | 404.7 D |
ab 111,00 €
