Zu "405165-61-9" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Besifloxacin Hydrochloride
Artikelnummer: TGM-T6406-100mg
Description: Besifloxacin Hydrochloride (BOL-303224-A) is a fourth-generation fluoroquinolone antibiotic. Target: Antibacterial, Antibiotic. Smiles: C1CCN(C[C@@H](C1)N)c1c(cc2c(c1Cl)n(cc(c2=O)C(=O)O)C1CC1)F.Cl. References: McDonald MB, et al. Ophthalmology, 2009, 116(9), 1615-1623.
| Schlagworte: | BOL-303224-A, Besifloxacin HCl, Besivance hydrochloride |
| Anwendung: | Antibacterial, Nucleic acid biosynthesis inhibitor |
| CAS | 405165-61-9 |
| MW: | 430.3 D |
ab 33,00 €
Besifloxacin (hydrochloride)
Artikelnummer: Cay23692-5
Besifloxacin is an ophthalmologic fluoroquinolone antibiotic that is active against Gram-negative and Gram-positive aerobic and anaerobic bacterial strains (MICs = 0.006-1.56 µg/ml). It inhibits LPS-stimulated production of the inflammatory cytokines IL-1beta, IL-8, IL-6, and IL-1alpha in human THP-1 monocytes....
| Schlagworte: | BOL-303224-A,... |
| Anwendung: | Antibiotic, Antibacterial, Nucleic acid biosynthesis inhibitor |
| CAS | 405165-61-9 |
| MW: | 430.3 D |
ab 60,00 €
Besifloxacin HCl
Artikelnummer: LKT-B1973.100
Besifloxacin is a 4th generation fluoroquinolone antibiotic that has broad-spectrum activity against aerobic and anaerobic bateria. It is more effective than gatifloxacin and moxifloxacin in reducing MRSA in the rabbit cornea.
| Schlagworte: | 7-[(3R) -3-aminoazepam- 1-yl]- 8-chloro- 1-cyclopropyl- 6-fluoro- 4-oxo- 1,4- dihydroquinoline- 3-carboxylic acid... |
| Anwendung: | DNA gyrase inhibitor, Topoisomerase IV inhibitor |
| CAS | 405165-61-9 |
| MW: | 430.31 D |
ab 175,00 €
