Zu "403811-55-2" wurden 3 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
10058-F4
Artikelnummer: TGM-T3048-100mg
Description: 10058-F4 (c-Myc Inhibitor) is a cell-permeable thiazolidinone that specifically inhibits the c-Myc-Max interaction and prevents transactivation of c-Myc target gene expression, induces cell-cycle arrest and apoptosis. Target: Autophagy, c-Myc. Smiles: CCC1=CC=C(\C=C2/SC(=S)NC2=O)C=C1. References: Huang...
| Schlagworte: | c-Myc Inhibitor |
| Anwendung: | c-Myc / Max dimerization inhibitor |
| CAS | 403811-55-2 |
| MW: | 249.35 D |
ab 43,00 €
10058-F4
Artikelnummer: Cay15929-5
The Myc proto-oncogenes interact with Max to form a dimer that regulates gene transcription. The protein c-Myc, in particular, promotes gene expression relevant to cell growth and thus drives cancer. 10058-F4 is a cell-permeable thiazolidinone that inhibits the dimerization of c-Myc and Max at 64 µM, preventing...
| Schlagworte: | 5-[(4-ethylphenyl)methylene]-2-thioxo-4-thiazolidinone |
| Anwendung: | c-Myc / Max dimerization inhibitor |
| CAS | 403811-55-2 |
| MW: | 249.4 D |
ab 86,00 €
![5-[(4-Ethylphenyl)methylene]-2-thioxo-4-thiazolidinone](https://www.biomol.com/media/image/42/10/ff/CDX-E0533-M005_200x200.png "5-[(4-Ethylphenyl)methylene]-2-thioxo-4-thiazolidinone")
5-[(4-Ethylphenyl)methylene]-2-thioxo-4-thiazolidinone
Artikelnummer: CDX-E0533-M005
c-Myc is a proto-oncogene that plays an important role in cell proliferation, differentiation, and apoptosis. 5-[(4-Ethylphenyl)methylene]-2-thioxo-4-thiazolidinone [10058-F4] is a cell-permeable thiazolidinone compound that specifically inhibits the c-Myc-Max interaction/dimerization at 64 µM, preventing...
| Schlagworte: | 10058-F4 |
| Anwendung: | Cell-permeable thiazolidinone c-Myc-Max interaction/dimerization inhibitor |
| CAS | 403811-55-2 |
| MW: | 249.35 D |
ab 61,00 €
