Zu "39777-61-2" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
TFEB activator 1
Artikelnummer: TGM-T8055-100mg
Description: TFEB activator 1 (Curcumin analog compound C1) is an activator of transcription factor EB (TFEB) with promise for the prevention or treatment of Alzheimer's disease. Target: Autophagy, Others. Smiles: COc1ccccc1\C=C\C(=O)\C=C\c1ccccc1OC. References: Song JX, et al. A novel curcumin analog binds to and...
| Schlagworte: | RPN77612, Curcumin analog compound C1, (1E,4E)-1,5-Bis(2-Methoxyphenyl)penta-1,, Curcumin analog C1 |
| Anwendung: | Synthetic curcuminoid, TFEB activator |
| CAS | 39777-61-2 |
| MW: | 294.34 D |
ab 37,00 €
Curcumin analog C1
Artikelnummer: Cay34255-1
Curcumin analog C1 is a synthetic curcuminoid. It inhibits the proliferation of HCT116 colon cancer cells (GI50 = 4 µM). Curcumin analog C1 (1 µM) activates transcription factor EB (TFEB), inducing nuclear translocation in Neuro2a mouse neuroblastoma cells. It increases LC3-II levels and promotes autophagic flux in...
| Schlagworte: | GO-Y019, TFEB Activator 1, (1E,4E)-1,5-bis(2-methoxyphenyl)-1,4-pentadien-3-one |
| Anwendung: | Synthetic curcuminoid, TFEB activator |
| CAS | 39777-61-2 |
| MW: | 294.3 D |
ab 39,00 €
