Zu "392-12-1" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
Indole-3-pyruvic acid
Artikelnummer: TGM-T4939-100mg
Description: Indole-3-pyruvic acid (3-(3-Indolyl)-2-oxopropanoic acid) is a compound involved in the biosynthesis of Indole-3-acetic acid, a plant hormone which plays important roles in regulating growth and responses to environmental changes. Target: Others. Smiles: OC(=O)C(=O)Cc1c[nH]c2ccccc12. References: Kneen...
| Schlagworte: | 3-(3-Indolyl)-2-oxopropanoic acid |
| CAS | 392-12-1 |
| MW: | 203.19 D |
ab 41,00 €
Indole-3-pyruvic Acid
Artikelnummer: Cay29876-250
Indole-3-pyruvic acid is an endogenous metabolite of tryptophan and intermediate in the biosynthesis of the major auxin hormone, indole-3-acetic acid (IAA, Cay-16954), in plants. Indole-3-pyruvic acid (50 and 250 µM) activates the aryl hydrocarbon receptor (AhR) in a reporter assay. It reduces UVB-induced...
| Schlagworte: | Indole-3-pyruvate, IPA, IPyr, NSC 88874, alpha-oxo-1H-indole-3-propanoic acid |
| Anwendung: | Endogenous tryptophan metabolite, auxin biosynthesis intermediate |
| CAS | 392-12-1 |
| MW: | 203.2 D |
ab 85,00 €
