Zu "390362-78-4" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
RHPS4
Artikelnummer: TGM-T6967-100mg
Description: RHPS4 (RHPS 4 methosulfate) is a potent inhibitor of Telomerase at submicromolar. Target: Apoptosis, Telomerase. Smiles: COS([O-])(=O)=O.Cc1cc2n(C)c3ccc(F)cc3c3[n+](C)c4ccc(F)cc4c(c1)c23. References: Phatak P, et al. Br J Cancer. 2007, 96(8):1223-33.
| Schlagworte: | RHPS 4 methosulfate, NSC714187 |
| Anwendung: | Telomerase inhibitor |
| CAS | 390362-78-4 |
| MW: | 458.48 D |
ab 41,00 €
RHPS4 (methyl sulfate)
Artikelnummer: Cay28543-10
RHPS4 is a telomerase inhibitor (IC50 = 0.33 µM). It is a ligand for the guanine quadruplex (G-quadruplex), a four-stranded DNA secondary structure formed from G-rich DNA sequences, that intercalates and stabilizes the G-quadruplex, which inhibits the activity of telomerase. RHPS4 (1 µM) induces phosphorylation of...
| Schlagworte: | 3,11-difluorohydro-6,8,13-trimethyl-quino[4,3,2-kl]acridinium, methyl sulfate |
| Anwendung: | Telomerase inhibitor |
| CAS | 390362-78-4 |
| MW: | 458.5 D |
ab 77,00 €
