Zu "39025-23-5" wurden 2 Artikel gefunden!
Für die Filterung wurden keine Ergebnisse gefunden!
(Z)-Guggulsterone
Artikelnummer: TGM-T17280-100mg
Description: (Z)-Guggulsterone inhibits the growth of human prostate cancer cells by causing apoptosis. Z-guggulsterone inhibits angiogenesis by suppressing the VEGF-VEGF-R2-Akt signaling axis. Target: Apoptosis, Akt, VEGFR. Smiles: C\C=C1/C(=O)C[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]12C. References: Xiao...
| Anwendung: | FXR antagonist |
| CAS | 39025-23-5 |
| MW: | 312.45 D |
ab 89,00 €
(Z)-Guggulsterone
Artikelnummer: Cay71800-5
(Z)-Guggulsterone demonstrates antitumor-promoting effects inhibiting both constitutive and interleukin-6-induced STAT3 activation in human multiple myeloma cells and suppressing the VEGF-VEGF/R2-Akt signaling axis in DU145 human prostate cancer cells.Formal Name: pregna-4,17Z(20)-diene-3,16-dione. CAS Number:...
| Schlagworte: | pregna-4,17Z(20)-diene-3,16-dione |
| Anwendung: | FXR antagonist |
| CAS | 39025-23-5 |
| MW: | 312.5 D |
ab 60,00 €
